🎯⭐ INTERACTIVE LESSON

Weak Acids, Weak Bases, and K_a/K_b

Learn step-by-step with interactive practice!

Loading lesson...

Weak Acids, Weak Bases, and K_a/K_b - Complete Interactive Lesson

Part 1: Weak Acid Equilibria

⚖️ Weak Acid Equilibrium

Part 1 of 7 — The KaK_a Expression

Unlike strong acids that dissociate completely, weak acids only partially ionize in water. This partial ionization is an equilibrium process described by the acid dissociation constant, KaK_a.

Weak Acid Dissociation

A generic weak acid HAHA in water:

HA(aq)H+(aq)+A(aq)HA(aq) \rightleftharpoons H^+(aq) + A^-(aq)

The equilibrium expression is:

Ka=[H+][A][HA]K_a = \frac{[H^+][A^-]}{[HA]}

Key Features

  • KaK_a is small (typically 10210^{-2} to 101210^{-12}) because weak acids are mostly undissociated
  • Larger KaK_a = stronger weak acid (more dissociation)
  • Smaller KaK_a = weaker acid (less dissociation)
  • Water is omitted from the expression (pure liquid)

Common Weak Acids and Their KaK_a Values

AcidFormulaKaK_apKapK_a
HydrofluoricHFHF6.8×1046.8 \times 10^{-4}3.17
AceticCH3COOHCH_3COOH1.8×1051.8 \times 10^{-5}4.74
CarbonicH2CO3H_2CO_34.3×1074.3 \times 10^{-7}6.37
HydrocyanicHCNHCN6.2×10106.2 \times 10^{-10}9.21

Relative strength: HF>CH3COOH>H2CO3>HCNHF > CH_3COOH > H_2CO_3 > HCN

The pKapK_a Scale

Just as pH=log[H+]pH = -\log[H^+], we define:

pKa=logKapK_a = -\log K_a

Interpreting pKapK_a

  • Lower pKapK_astronger acid (larger KaK_a)
  • Higher pKapK_aweaker acid (smaller KaK_a)

This is the inverse relationship — don't mix it up!

KaK_apKapK_aRelative Strength
10210^{-2}2Relatively strong weak acid
10510^{-5}5Moderate weak acid
101010^{-10}10Very weak acid

Converting Between KaK_a and pKapK_a

Ka=10pKapKa=logKaK_a = 10^{-pK_a} \qquad pK_a = -\log K_a

Weak Acid Concept Check 🎯

Strong vs. Weak Acids: Key Differences

PropertyStrong AcidWeak Acid
Dissociation100% completePartial (equilibrium)
Arrow in equation\rightarrow (single)\rightleftharpoons (double)
[H+][H^+]Equal to initial [HA][HA]Much less than initial [HA][HA]
Need KaK_a?NoYes
pH calculationDirect: pH=logCpH = -\log CRequires ICE table
Conducts electricityBetter (more ions)Less well (fewer ions)

Important

At the same concentration, a strong acid always has a lower pH (more acidic) than a weak acid because more H+H^+ is produced.

For example, 0.10 M HClHCl: pH=1.00pH = 1.00

But 0.10 M CH3COOHCH_3COOH: pH=2.87pH = 2.87 (we'll calculate this in Part 2)

Weak Acid Fundamentals 🔍

KaK_a and pKapK_a Conversions 🧮

  1. Convert Ka=1.8×105K_a = 1.8 \times 10^{-5} to pKapK_a (3 significant figures)

  2. Convert pKa=9.21pK_a = 9.21 to KaK_a (Enter in scientific notation, e.g. 6.2e-10)

  3. Rank by acid strength (enter strongest): Acid A (pKa=2.1pK_a = 2.1), Acid B (pKa=6.5pK_a = 6.5), Acid C (pKa=4.3pK_a = 4.3). Enter A, B, or C.

Exit Quiz — Weak Acid Equilibrium

Part 2: Ka & Percent Ionization

🧊 ICE Tables for Weak Acids

Part 2 of 7 — Calculating pH of Weak Acid Solutions

The ICE table (Initial, Change, Equilibrium) is the essential tool for calculating the pH of weak acid solutions. Combined with the 5% approximation, it simplifies calculations dramatically.

Setting Up an ICE Table

For a weak acid HAHA with initial concentration CC and acid dissociation constant KaK_a:

HA(aq)H+(aq)+A(aq)HA(aq) \rightleftharpoons H^+(aq) + A^-(aq)

HAHAH+H^+AA^-
ICC0000
Cx-x+x+x+x+x
ECxC - xxxxx

Substituting into KaK_a:

Ka=xxCx=x2CxK_a = \frac{x \cdot x}{C - x} = \frac{x^2}{C - x}

This is a quadratic equation in xx. But we can often avoid the quadratic formula!

The 5% Approximation

If xCx \ll C (specifically, if x<5%x < 5\% of CC), we can approximate:

CxCC - x \approx C

This simplifies the equation to:

Kax2CK_a \approx \frac{x^2}{C}

x=KaCx = \sqrt{K_a \cdot C}

[H+]=x=KaC[H^+] = x = \sqrt{K_a \cdot C}

pH=log(KaC)pH = -\log(\sqrt{K_a \cdot C})

When Does the Approximation Work?

The approximation is valid when:

CKa>400(conservative rule)\frac{C}{K_a} > 400 \quad \text{(conservative rule)}

Or equivalently, when xC×100%<5%\frac{x}{C} \times 100\% < 5\%.

If the Approximation Fails

Use the quadratic formula:

x2+KaxKaC=0x^2 + K_a x - K_a C = 0

x=Ka+Ka2+4KaC2x = \frac{-K_a + \sqrt{K_a^2 + 4K_a C}}{2}

(Take the positive root only — concentrations can't be negative!)

Worked Example

Find the pH of 0.10 M acetic acid (CH3COOHCH_3COOH, Ka=1.8×105K_a = 1.8 \times 10^{-5}).

Step 1: Check if approximation works

CKa=0.101.8×105=5556>400\frac{C}{K_a} = \frac{0.10}{1.8 \times 10^{-5}} = 5556 > 400 \quad \checkmark

Step 2: Use the simplified equation

x=KaC=(1.8×105)(0.10)x = \sqrt{K_a \cdot C} = \sqrt{(1.8 \times 10^{-5})(0.10)}

x=1.8×106=1.34×103 Mx = \sqrt{1.8 \times 10^{-6}} = 1.34 \times 10^{-3} \text{ M}

Step 3: Verify the 5% check

xC×100%=1.34×1030.10×100%=1.3%<5%\frac{x}{C} \times 100\% = \frac{1.34 \times 10^{-3}}{0.10} \times 100\% = 1.3\% < 5\% \quad \checkmark

Step 4: Calculate pH

pH=log(1.34×103)=2.87pH = -\log(1.34 \times 10^{-3}) = 2.87

Compare: 0.10 M HClHCl has pH=1.00pH = 1.00. Same concentration, but the weak acid has a much higher pH!

ICE Table Concept Check 🎯

Weak Acid pH Calculations 🧮

  1. Find the pH of 0.25 M HFHF (Ka=6.8×104K_a = 6.8 \times 10^{-4}). (2 decimal places)

  2. Find [H+][H^+] for 0.050 M HCNHCN (Ka=6.2×1010K_a = 6.2 \times 10^{-10}). (Enter in scientific notation, e.g. 5.6e-6)

  3. What is the percent ionization of 0.10 M acetic acid ([H+]=1.34×103[H^+] = 1.34 \times 10^{-3} M)? (1 decimal place, enter number only)

ICE Table Reasoning 🔍

Exit Quiz — ICE Tables for Weak Acids

Part 3: Weak Base Equilibria & Kb

🧴 Weak Bases and KbK_b

Part 3 of 7 — The Base Dissociation Constant

Weak bases partially react with water to produce OHOH^- ions. The extent of this reaction is measured by the base dissociation constant, KbK_b.

Weak Base Equilibrium

A generic weak base BB in water:

B(aq)+H2O(l)BH+(aq)+OH(aq)B(aq) + H_2O(l) \rightleftharpoons BH^+(aq) + OH^-(aq)

The equilibrium expression is:

Kb=[BH+][OH][B]K_b = \frac{[BH^+][OH^-]}{[B]}

Key Points

  • Water is omitted (pure liquid)
  • KbK_b is small → partial reaction only
  • Larger KbK_b = stronger weak base
  • The base accepts a proton from water (Brønsted-Lowry)

Common Weak Bases

BaseFormulaKbK_bpKbpK_b
AmmoniaNH3NH_31.8×1051.8 \times 10^{-5}4.74
MethylamineCH3NH2CH_3NH_24.4×1044.4 \times 10^{-4}3.36
PyridineC5H5NC_5H_5N1.7×1091.7 \times 10^{-9}8.77
AnilineC6H5NH2C_6H_5NH_24.3×10104.3 \times 10^{-10}9.37

Relative strength: CH3NH2>NH3>C5H5N>C6H5NH2CH_3NH_2 > NH_3 > C_5H_5N > C_6H_5NH_2

ICE Table for Weak Bases

For NH3NH_3 at concentration CC:

NH3(aq)+H2O(l)NH4+(aq)+OH(aq)NH_3(aq) + H_2O(l) \rightleftharpoons NH_4^+(aq) + OH^-(aq)

NH3NH_3NH4+NH_4^+OHOH^-
ICC0000
Cx-x+x+x+x+x
ECxC - xxxxx

Kb=x2Cxx2CK_b = \frac{x^2}{C - x} \approx \frac{x^2}{C}

x=[OH]=KbCx = [OH^-] = \sqrt{K_b \cdot C}

Then: pOH=log[OH]pOH = -\log[OH^-] and pH=14pOHpH = 14 - pOH

Worked Example

Find the pH of 0.15 M NH3NH_3 (Kb=1.8×105K_b = 1.8 \times 10^{-5}).

[OH]=(1.8×105)(0.15)=2.7×106=1.64×103 M[OH^-] = \sqrt{(1.8 \times 10^{-5})(0.15)} = \sqrt{2.7 \times 10^{-6}} = 1.64 \times 10^{-3} \text{ M}

pOH=log(1.64×103)=2.79pOH = -\log(1.64 \times 10^{-3}) = 2.79

pH=142.79=11.21pH = 14 - 2.79 = 11.21

5% check: 1.64×103/0.15=1.1%<5%1.64 \times 10^{-3}/0.15 = 1.1\% < 5\%

Weak Base Concept Check 🎯

Conjugate Bases of Weak Acids

The conjugate base of a weak acid also acts as a weak base in water:

A(aq)+H2O(l)HA(aq)+OH(aq)A^-(aq) + H_2O(l) \rightleftharpoons HA(aq) + OH^-(aq)

Kb=[HA][OH][A]K_b = \frac{[HA][OH^-]}{[A^-]}

Example: Acetate Ion

CH3COO(aq)+H2O(l)CH3COOH(aq)+OH(aq)CH_3COO^-(aq) + H_2O(l) \rightleftharpoons CH_3COOH(aq) + OH^-(aq)

This is why solutions of sodium acetate (NaCH3COONaCH_3COO) are basic — the acetate ion is a weak base!

Salts and pH

Salt TypeExamplepH
Strong acid + strong baseNaClNaCl7 (neutral)
Weak acid + strong baseNaCH3COONaCH_3COO> 7 (basic)
Strong acid + weak baseNH4ClNH_4Cl< 7 (acidic)
Weak acid + weak baseNH4CH3COONH_4CH_3COODepends on KaK_a vs KbK_b

Weak Base Calculations 🧮

  1. Find the pH of 0.20 M methylamine (CH3NH2CH_3NH_2, Kb=4.4×104K_b = 4.4 \times 10^{-4}). (2 decimal places)

  2. Find [OH][OH^-] for 0.10 M pyridine (C5H5NC_5H_5N, Kb=1.7×109K_b = 1.7 \times 10^{-9}). (Enter in scientific notation, e.g. 1.3e-5)

  3. A solution of 0.25 M NaCH3COONaCH_3COO is basic. If KbK_b for CH3COOCH_3COO^- is 5.6×10105.6 \times 10^{-10}, find the pH. (2 decimal places)

Weak Base Reasoning 🔍

Exit Quiz — Weak Bases

Part 4: Relationship Between Ka & Kb

🔗 The Ka×Kb=KwK_a \times K_b = K_w Relationship

Part 4 of 7 — Connecting Conjugate Pairs

One of the most powerful relationships in acid-base chemistry connects the strength of a conjugate acid-base pair through the ion product of water.

Deriving the Relationship

Consider acetic acid and its conjugate base, acetate:

Acid dissociation:

CH3COOHH++CH3COOKa=[H+][CH3COO][CH3COOH]CH_3COOH \rightleftharpoons H^+ + CH_3COO^- \qquad K_a = \frac{[H^+][CH_3COO^-]}{[CH_3COOH]}

Base hydrolysis (conjugate base):

CH3COO+H2OCH3COOH+OHKb=[CH3COOH][OH][CH3COO]CH_3COO^- + H_2O \rightleftharpoons CH_3COOH + OH^- \qquad K_b = \frac{[CH_3COOH][OH^-]}{[CH_3COO^-]}

Multiply Ka×KbK_a \times K_b:

Ka×Kb=[H+][CH3COO][CH3COOH]×[CH3COOH][OH][CH3COO]K_a \times K_b = \frac{[H^+][CH_3COO^-]}{[CH_3COOH]} \times \frac{[CH_3COOH][OH^-]}{[CH_3COO^-]}

Ka×Kb=[H+][OH]=KwK_a \times K_b = [H^+][OH^-] = K_w

Ka×Kb=Kw=1.0×1014 at 25°C\boxed{K_a \times K_b = K_w = 1.0 \times 10^{-14} \text{ at 25°C}}

This is true for any conjugate acid-base pair!

The pKa+pKb=14pK_a + pK_b = 14 Relationship

Taking log-\log of both sides of Ka×Kb=KwK_a \times K_b = K_w:

logKa+(logKb)=logKw-\log K_a + (-\log K_b) = -\log K_w

pKa+pKb=pKw=14 at 25°C\boxed{pK_a + pK_b = pK_w = 14 \text{ at 25°C}}

Applications

If you know KaK_a for an acid, you can find KbK_b for its conjugate base:

Kb=KwKa=1.0×1014KaK_b = \frac{K_w}{K_a} = \frac{1.0 \times 10^{-14}}{K_a}

Example

CH3COOHCH_3COOH has Ka=1.8×105K_a = 1.8 \times 10^{-5}. What is KbK_b for CH3COOCH_3COO^-?

Kb=1.0×10141.8×105=5.6×1010K_b = \frac{1.0 \times 10^{-14}}{1.8 \times 10^{-5}} = 5.6 \times 10^{-10}

pKb=144.74=9.26pK_b = 14 - 4.74 = 9.26

Key Insight

  • Strong acid (KaK_a very large) → very weak conjugate base (KbK_b very small)
  • Weak acid (KaK_a small) → relatively stronger conjugate base (KbK_b less small)

Ka×KbK_a \times K_b Concept Check 🎯

KaK_a/KbK_b Conversion Drill 🧮

  1. HFHF has Ka=6.8×104K_a = 6.8 \times 10^{-4}. Find KbK_b for FF^-. (Enter in scientific notation, e.g. 1.5e-11)

  2. NH3NH_3 has Kb=1.8×105K_b = 1.8 \times 10^{-5}. Find KaK_a for NH4+NH_4^+. (Enter in scientific notation, e.g. 5.6e-10)

  3. A weak acid has pKa=3.75pK_a = 3.75. Find pKbpK_b for its conjugate base. (3 significant figures)

Using Ka/KbK_a/K_b to Predict Salt Solutions

For salts of weak acid + strong base (e.g., NaCH3COONaCH_3COO):

  1. Identify the ion that reacts with water (CH3COOCH_3COO^-)
  2. Find its KbK_b using Kb=Kw/KaK_b = K_w/K_a
  3. Use ICE table with KbK_b to find [OH][OH^-]
  4. Convert to pH

Example: pH of 0.20 M NaCN

Ka(HCN)=6.2×1010K_a(HCN) = 6.2 \times 10^{-10}Kb(CN)=1.6×105K_b(CN^-) = 1.6 \times 10^{-5}

[OH]=(1.6×105)(0.20)=3.2×106=1.8×103 M[OH^-] = \sqrt{(1.6 \times 10^{-5})(0.20)} = \sqrt{3.2 \times 10^{-6}} = 1.8 \times 10^{-3} \text{ M}

pOH=2.74pH=11.26pOH = 2.74 \qquad pH = 11.26

Conjugate Pair Strength 🔍

Exit Quiz — Ka×Kb=KwK_a \times K_b = K_w

Part 5: Polyprotic Acids

📈 Percent Ionization and Polyprotic Acids

Part 5 of 7 — Advanced Weak Acid Concepts

This part covers two important topics: how concentration affects the degree of dissociation, and how acids with multiple ionizable protons behave.

Percent Ionization

Percent ionization=[H+]eq[HA]0×100%\text{Percent ionization} = \frac{[H^+]_{eq}}{[HA]_0} \times 100\%

Key Trend

For a given weak acid, diluting the solution increases percent ionization.

Why? Le Chatelier's principle: dilution shifts the equilibrium HAH++AHA \rightleftharpoons H^+ + A^- to the right (toward more ions, since there are more moles of product than reactant).

Mathematical Proof

[H+]=KaC[H^+] = \sqrt{K_a \cdot C}

% ionization=KaCC×100=KaC×100\text{\% ionization} = \frac{\sqrt{K_a \cdot C}}{C} \times 100 = \frac{\sqrt{K_a}}{\sqrt{C}} \times 100

As CC decreases, 1C\frac{1}{\sqrt{C}} increases, so percent ionization increases!

Example: 0.10 M vs 0.010 M Acetic Acid

Concentration[H+][H^+]% Ionization
0.10 M1.34×1031.34 \times 10^{-3}1.3%
0.010 M4.24×1044.24 \times 10^{-4}4.2%
0.0010 M1.34×1041.34 \times 10^{-4}13.4%

Polyprotic Acids

Polyprotic acids can donate more than one proton. Each dissociation has its own KaK_a.

Diprotic Acid Example: H2SO3H_2SO_3

H2SO3H++HSO3Ka1=1.5×102H_2SO_3 \rightleftharpoons H^+ + HSO_3^- \qquad K_{a1} = 1.5 \times 10^{-2}

HSO3H++SO32Ka2=6.3×108HSO_3^- \rightleftharpoons H^+ + SO_3^{2-} \qquad K_{a2} = 6.3 \times 10^{-8}

Triprotic Acid Example: H3PO4H_3PO_4

H3PO4H++H2PO4Ka1=7.5×103H_3PO_4 \rightleftharpoons H^+ + H_2PO_4^- \qquad K_{a1} = 7.5 \times 10^{-3}

H2PO4H++HPO42Ka2=6.2×108H_2PO_4^- \rightleftharpoons H^+ + HPO_4^{2-} \qquad K_{a2} = 6.2 \times 10^{-8}

HPO42H++PO43Ka3=4.8×1013HPO_4^{2-} \rightleftharpoons H^+ + PO_4^{3-} \qquad K_{a3} = 4.8 \times 10^{-13}

Critical Rule

Ka1Ka2Ka3K_{a1} \gg K_{a2} \gg K_{a3}

Each successive dissociation is much weaker because it's harder to remove H+H^+ from an increasingly negative ion.

Practical Consequence

For pH calculations, only the first dissociation matters (in most cases). The second and third contribute negligible additional [H+][H^+].

Percent Ionization & Polyprotic Acids 🎯

Percent Ionization & Polyprotic Calculations 🧮

  1. What is the percent ionization of 0.050 M HFHF (Ka=6.8×104K_a = 6.8 \times 10^{-4})? (1 decimal place)

  2. Find the pH of 0.10 M H3PO4H_3PO_4 (Ka1=7.5×103K_{a1} = 7.5 \times 10^{-3}). Use only the first dissociation. (2 decimal places)

  3. For H2CO3H_2CO_3 (Ka1=4.3×107K_{a1} = 4.3 \times 10^{-7}, Ka2=4.7×1011K_{a2} = 4.7 \times 10^{-11}), what is [CO32][CO_3^{2-}] in a 0.10 M solution? (Enter in scientific notation, e.g. 4.7e-11)

Advanced Concepts 🔍

Exit Quiz — Percent Ionization & Polyprotic Acids

Part 6: Problem-Solving Workshop

🛠️ Problem-Solving Workshop

Part 6 of 7 — Weak Acids, Bases, and KaK_a/KbK_b

This workshop brings together ICE tables, KaK_a/KbK_b relationships, percent ionization, and polyprotic acid concepts in multi-step AP-style problems.

Problem 1: Complete Weak Acid Analysis

A 0.20 M solution of benzoic acid (C6H5COOHC_6H_5COOH, Ka=6.3×105K_a = 6.3 \times 10^{-5}) is prepared.

Step 1: Check the approximation

C/Ka=0.20/(6.3×105)=3175>400C/K_a = 0.20/(6.3 \times 10^{-5}) = 3175 > 400

Step 2: Calculate [H+][H^+]

[H+]=KaC=(6.3×105)(0.20)=1.26×105=3.55×103 M[H^+] = \sqrt{K_a \cdot C} = \sqrt{(6.3 \times 10^{-5})(0.20)} = \sqrt{1.26 \times 10^{-5}} = 3.55 \times 10^{-3} \text{ M}

Step 3: pH

pH=log(3.55×103)=2.45pH = -\log(3.55 \times 10^{-3}) = 2.45

Step 4: Percent ionization

%=(3.55×103/0.20)×100=1.8%\% = (3.55 \times 10^{-3}/0.20) \times 100 = 1.8\% ✓ (under 5%)

Step 5: KbK_b of conjugate base

Kb(C6H5COO)=Kw/Ka=1.0×1014/(6.3×105)=1.6×1010K_b(C_6H_5COO^-) = K_w/K_a = 1.0 \times 10^{-14}/(6.3 \times 10^{-5}) = 1.6 \times 10^{-10}

Your Turn: Complete Analysis 🧮

Perform the same analysis for 0.15 M HNO2HNO_2 (Ka=4.5×104K_a = 4.5 \times 10^{-4}):

  1. What is [H+][H^+]? (Enter in scientific notation, e.g. 8.2e-3)

  2. What is the pH? (2 decimal places)

  3. What is the percent ionization? (1 decimal place, enter number only)

Problem 2: Salt Solution pH

What is the pH of 0.30 M sodium fluoride (NaFNaF)?

Analysis

NaFNaF dissociates completely: Na+Na^+ (spectator) + FF^- (conjugate base of HFHF)

FF^- is a weak base: F+H2OHF+OHF^- + H_2O \rightleftharpoons HF + OH^-

Find KbK_b

Ka(HF)=6.8×104K_a(HF) = 6.8 \times 10^{-4}

Kb(F)=KwKa=1.0×10146.8×104=1.47×1011K_b(F^-) = \frac{K_w}{K_a} = \frac{1.0 \times 10^{-14}}{6.8 \times 10^{-4}} = 1.47 \times 10^{-11}

ICE Table

[OH]=KbC=(1.47×1011)(0.30)=2.10×106 M[OH^-] = \sqrt{K_b \cdot C} = \sqrt{(1.47 \times 10^{-11})(0.30)} = 2.10 \times 10^{-6} \text{ M}

pOH=5.68pH=145.68=8.32pOH = 5.68 \qquad pH = 14 - 5.68 = 8.32

Salt Solution Practice 🎯

Problem 3: Determining KaK_a from pH 🧮

A 0.25 M solution of an unknown weak acid has a pH of 2.72.

  1. What is [H+][H^+]? (Enter in scientific notation, e.g. 1.9e-3)

  2. What is the KaK_a of the acid? (Enter in scientific notation, e.g. 1.5e-5)

  3. What is the pKapK_a? (2 decimal places)

Workshop Synthesis 🔍

Exit Quiz — Problem-Solving Workshop

Part 7: Synthesis & AP Review

🎓 Synthesis & AP Review

Part 7 of 7 — Weak Acids, Bases, and KaK_a/KbK_b

This final part provides comprehensive AP-style review covering all weak acid/base concepts: KaK_a/KbK_b calculations, ICE tables, the 5% approximation, percent ionization, polyprotic acids, and salt solutions.

Complete Summary

Key Equations

ConceptEquation
Weak acid [H+][H^+][H+]=KaC[H^+] = \sqrt{K_a \cdot C} (with 5% check)
Weak base [OH][OH^-][OH]=KbC[OH^-] = \sqrt{K_b \cdot C}
Conjugate pair linkKa×Kb=Kw=1.0×1014K_a \times K_b = K_w = 1.0 \times 10^{-14}
p-notation linkpKa+pKb=14pK_a + pK_b = 14
Percent ionization%=([H+]/C)×100\% = ([H^+]/C) \times 100
5% rule thresholdC/Ka>400C/K_a > 400

Decision Flowchart

  1. Strong acid/base? → Use concentration directly
  2. Weak acid? → ICE table with KaK_a
  3. Weak base? → ICE table with KbK_b, find [OH][OH^-] first
  4. Salt? → Identify hydrolyzable ion, use Kb=Kw/KaK_b = K_w/K_a or Ka=Kw/KbK_a = K_w/K_b
  5. Always check the 5% approximation!

AP-Style Questions — Set 1 🎯

AP Calculation Practice 🧮

  1. Calculate the pH of 0.35 M NH3NH_3 (Kb=1.8×105K_b = 1.8 \times 10^{-5}). (2 decimal places)

  2. What is KaK_a for NH4+NH_4^+? (Enter in scientific notation, e.g. 5.6e-10)

  3. A solution of 0.10 M NH4ClNH_4Cl has what pH? (2 decimal places)

AP-Style Questions — Set 2 🎯

Comprehensive Review 🔍

Final Exit Quiz — Weak Acids & Bases